C17H22N2O2 — CID 86922752
N-cyclopropyl-N-ethyl-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 86922752) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-cyclopropyl-N-ethyl-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 86922752 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-cyclopropyl-N-ethyl-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | CCN(C(=O)c1ccc(CN2CCCC2=O)cc1)C1CC1 |
| InChI | InChI=1S/C17H22N2O2/c1-2-19(15-9-10-15)17(21)14-7-5-13(6-8-14)12-18-11-3-4-16(18)20/h5-8,15H,2-4,9-12H2,1H3 |
| InChIKey | NGMCPMAIMWOODA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |