About imidazo[2,1-a]isoquinoline-2-carbohydrazide
imidazo[2,1-a]isoquinoline-2-carbohydrazide (PubChem CID 869249) has the molecular formula C12H10N4O
and a molecular weight of 226.24 g/mol. Its IUPAC name is imidazo[2,1-a]isoquinoline-2-carbohydrazide.
Molecular Properties
| Compound Name | imidazo[2,1-a]isoquinoline-2-carbohydrazide |
| PubChem CID | 869249 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | imidazo[2,1-a]isoquinoline-2-carbohydrazide |
| SMILES | NNC(=O)c1cn2ccc3ccccc3c2n1 |
| InChI | InChI=1S/C12H10N4O/c13-15-12(17)10-7-16-6-5-8-3-1-2-4-9(8)11(16)14-10/h1-7H,13H2,(H,15,17) |
| InChIKey | WSNWYZBDIKCPIG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze imidazo[2,1-a]isoquinoline-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[2,1-a]isoquinoline-2-carbohydrazide?
The IUPAC name of imidazo[2,1-a]isoquinoline-2-carbohydrazide (CID 869249) is imidazo[2,1-a]isoquinoline-2-carbohydrazide.
What is the SMILES notation for imidazo[2,1-a]isoquinoline-2-carbohydrazide?
The canonical SMILES for imidazo[2,1-a]isoquinoline-2-carbohydrazide is NNC(=O)c1cn2ccc3ccccc3c2n1.
What is the InChIKey of imidazo[2,1-a]isoquinoline-2-carbohydrazide?
The InChIKey is WSNWYZBDIKCPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O/c13-15-12(17)10-7-16-6-5-8-3-1-2-4-9(8)11(16)14-10/h1-7H,13H2,(H,15,17).
What are the key properties of imidazo[2,1-a]isoquinoline-2-carbohydrazide?
imidazo[2,1-a]isoquinoline-2-carbohydrazide has a molecular weight of 226.24 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[2,1-a]isoquinoline-2-carbohydrazide is sourced from PubChem (CID 869249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).