C25H32N6O2 — CID 86925657
(6-ethoxy-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)-[1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidin-4-yl]methanone (PubChem CID 86925657) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is (6-ethoxy-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)-[1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidin-4-yl]methanone.
| Compound Name | (6-ethoxy-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)-[1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 86925657 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (6-ethoxy-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)-[1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidin-4-yl]methanone |
| SMILES | CCOc1ccc2c(c1)C(C)CC(C)(C)N2C(=O)C1CCN(c2ccc3nncn3n2)CC1 |
| InChI | InChI=1S/C25H32N6O2/c1-5-33-19-6-7-21-20(14-19)17(2)15-25(3,4)31(21)24(32)18-10-12-29(13-11-18)23-9-8-22-27-26-16-30(22)28-23/h6-9,14,16-18H,5,10-13,15H2,1-4H3 |
| InChIKey | IQQOEXVWJYOJMZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |