C21H20N2O2 — CID 86926399
N-cyclopropyl-N-[(3-methylphenyl)methyl]-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 86926399) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3-methylphenyl)methyl]-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-cyclopropyl-N-[(3-methylphenyl)methyl]-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 86926399 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-cyclopropyl-N-[(3-methylphenyl)methyl]-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | Cc1cccc(CN(C(=O)c2cc3ccccc3c(=O)[nH]2)C2CC2)c1 |
| InChI | InChI=1S/C21H20N2O2/c1-14-5-4-6-15(11-14)13-23(17-9-10-17)21(25)19-12-16-7-2-3-8-18(16)20(24)22-19/h2-8,11-12,17H,9-10,13H2,1H3,(H,22,24) |
| InChIKey | GXRXIGWIUPWKIT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |