C14H20ClN3O2S — CID 86927868
3-[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 86927868) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is 3-[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86927868 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCN(CCN1C(=O)NC(C)(C)C1=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H20ClN3O2S/c1-4-17(9-10-5-6-11(15)21-10)7-8-18-12(19)14(2,3)16-13(18)20/h5-6H,4,7-9H2,1-3H3,(H,16,20) |
| InChIKey | DZLJPMVVOMSDNF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|