About 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one
8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 86928521) has the molecular formula C18H15N3OS
and a molecular weight of 321.41 g/mol. Its IUPAC name is 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one |
| PubChem CID | 86928521 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | Cc1cccc2c1NC(c1csc(-c3ccccc3)n1)NC2=O |
| InChI | InChI=1S/C18H15N3OS/c1-11-6-5-9-13-15(11)20-16(21-17(13)22)14-10-23-18(19-14)12-7-3-2-4-8-12/h2-10,16,20H,1H3,(H,21,22) |
| InChIKey | RUSXBQNAEFCLTQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one?
The IUPAC name of 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one (CID 86928521) is 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one.
What is the SMILES notation for 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one?
The canonical SMILES for 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one is Cc1cccc2c1NC(c1csc(-c3ccccc3)n1)NC2=O.
What is the InChIKey of 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one?
The InChIKey is RUSXBQNAEFCLTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3OS/c1-11-6-5-9-13-15(11)20-16(21-17(13)22)14-10-23-18(19-14)12-7-3-2-4-8-12/h2-10,16,20H,1H3,(H,21,22).
What are the key properties of 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one?
8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one has a molecular weight of 321.41 g/mol, XLogP of 3.97, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2-(2-phenyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-quinazolin-4-one is sourced from PubChem (CID 86928521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).