C16H27F3N2O3 — CID 86928855
1-(2,2-dimethylpropanoyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboxamide (PubChem CID 86928855) has the molecular formula C16H27F3N2O3 and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86928855 |
| Molecular Formula | C16H27F3N2O3 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCC(C(=O)NCCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H27F3N2O3/c1-15(2,3)14(23)21-8-5-12(6-9-21)13(22)20-7-4-10-24-11-16(17,18)19/h12H,4-11H2,1-3H3,(H,20,22) |
| InChIKey | UMCPHHWILOFNEC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|