About N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide
N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide (PubChem CID 86929027) has the molecular formula C10H12F3NO3
and a molecular weight of 251.20 g/mol. Its IUPAC name is N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide.
Molecular Properties
| Compound Name | N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide |
| PubChem CID | 86929027 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide |
| SMILES | O=C(NCCCOCC(F)(F)F)c1ccoc1 |
| InChI | InChI=1S/C10H12F3NO3/c11-10(12,13)7-17-4-1-3-14-9(15)8-2-5-16-6-8/h2,5-6H,1,3-4,7H2,(H,14,15) |
| InChIKey | SNSAMVPXJYXAME-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide?
The IUPAC name of N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide (CID 86929027) is N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide.
What is the SMILES notation for N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide?
The canonical SMILES for N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide is O=C(NCCCOCC(F)(F)F)c1ccoc1.
What is the InChIKey of N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide?
The InChIKey is SNSAMVPXJYXAME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3NO3/c11-10(12,13)7-17-4-1-3-14-9(15)8-2-5-16-6-8/h2,5-6H,1,3-4,7H2,(H,14,15).
What are the key properties of N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide?
N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide has a molecular weight of 251.20 g/mol, XLogP of 1.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,2,2-trifluoroethoxy)propyl]furan-3-carboxamide is sourced from PubChem (CID 86929027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).