C14H25NO2 — CID 86929298
N-[2-(cyclohexen-1-yl)ethyl]-3-propan-2-yloxypropanamide (PubChem CID 86929298) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-propan-2-yloxypropanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-propan-2-yloxypropanamide |
|---|---|
| PubChem CID | 86929298 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-propan-2-yloxypropanamide |
| SMILES | CC(C)OCCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C14H25NO2/c1-12(2)17-11-9-14(16)15-10-8-13-6-4-3-5-7-13/h6,12H,3-5,7-11H2,1-2H3,(H,15,16) |
| InChIKey | XOEWSKOVUOPFHF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|