C17H14Cl2N4O2 — CID 86929677
2-(3,4-dichlorophenoxy)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide (PubChem CID 86929677) has the molecular formula C17H14Cl2N4O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86929677 |
| Molecular Formula | C17H14Cl2N4O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)c(Cl)c1)Nc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C17H14Cl2N4O2/c18-15-6-5-14(7-16(15)19)25-9-17(24)22-13-3-1-12(2-4-13)8-23-11-20-10-21-23/h1-7,10-11H,8-9H2,(H,22,24) |
| InChIKey | LOZITXNDYGDNHP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |