C19H24N4O — CID 86930499
3-indol-1-yl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]propanamide (PubChem CID 86930499) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-indol-1-yl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]propanamide.
| Compound Name | 3-indol-1-yl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 86930499 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 3-indol-1-yl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]propanamide |
| SMILES | Cc1nn(C)c(C)c1CCNC(=O)CCn1ccc2ccccc21 |
| InChI | InChI=1S/C19H24N4O/c1-14-17(15(2)22(3)21-14)8-11-20-19(24)10-13-23-12-9-16-6-4-5-7-18(16)23/h4-7,9,12H,8,10-11,13H2,1-3H3,(H,20,24) |
| InChIKey | GOULDEAQRWRTAY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |