C14H17F3N4O2 — CID 86930566
1-methyl-5-pyrrol-1-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-carboxamide (PubChem CID 86930566) has the molecular formula C14H17F3N4O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 1-methyl-5-pyrrol-1-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-5-pyrrol-1-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86930566 |
| Molecular Formula | C14H17F3N4O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-methyl-5-pyrrol-1-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NCCCOCC(F)(F)F)c1-n1cccc1 |
| InChI | InChI=1S/C14H17F3N4O2/c1-20-13(21-6-2-3-7-21)11(9-19-20)12(22)18-5-4-8-23-10-14(15,16)17/h2-3,6-7,9H,4-5,8,10H2,1H3,(H,18,22) |
| InChIKey | SHEWIIOCOKGFGM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|