C17H26N4O2S — CID 86931195
1-benzyl-2-[2-[[butyl(methyl)sulfamoyl]amino]ethyl]imidazole (PubChem CID 86931195) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-benzyl-2-[2-[[butyl(methyl)sulfamoyl]amino]ethyl]imidazole.
| Compound Name | 1-benzyl-2-[2-[[butyl(methyl)sulfamoyl]amino]ethyl]imidazole |
|---|---|
| PubChem CID | 86931195 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-benzyl-2-[2-[[butyl(methyl)sulfamoyl]amino]ethyl]imidazole |
| SMILES | CCCCN(C)S(=O)(=O)NCCc1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C17H26N4O2S/c1-3-4-13-20(2)24(22,23)19-11-10-17-18-12-14-21(17)15-16-8-6-5-7-9-16/h5-9,12,14,19H,3-4,10-11,13,15H2,1-2H3 |
| InChIKey | SGDATFXVSFEVOO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |