C13H14FN3O3 — CID 86932561
2-(2,5-dioxoimidazolidin-1-yl)-N-[(2-fluorophenyl)methyl]-N-methylacetamide (PubChem CID 86932561) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-[(2-fluorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[(2-fluorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 86932561 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[(2-fluorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccccc1F)C(=O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C13H14FN3O3/c1-16(7-9-4-2-3-5-10(9)14)12(19)8-17-11(18)6-15-13(17)20/h2-5H,6-8H2,1H3,(H,15,20) |
| InChIKey | JZKCRSYOUYEVEN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|