C20H23FN2O2S — CID 86933555
3-fluoro-4-methyl-N-[2-[(2-methyl-3-phenylsulfanylpropanoyl)amino]ethyl]benzamide (PubChem CID 86933555) has the molecular formula C20H23FN2O2S and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[(2-methyl-3-phenylsulfanylpropanoyl)amino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[(2-methyl-3-phenylsulfanylpropanoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 86933555 |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[(2-methyl-3-phenylsulfanylpropanoyl)amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)C(C)CSc2ccccc2)cc1F |
| InChI | InChI=1S/C20H23FN2O2S/c1-14-8-9-16(12-18(14)21)20(25)23-11-10-22-19(24)15(2)13-26-17-6-4-3-5-7-17/h3-9,12,15H,10-11,13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | KHPXZXLUBBNECF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|