About 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone
1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone (PubChem CID 86933717) has the molecular formula C17H16Cl2N2OS
and a molecular weight of 367.30 g/mol. Its IUPAC name is 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone.
Molecular Properties
| Compound Name | 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone |
| PubChem CID | 86933717 |
| Molecular Formula | C17H16Cl2N2OS |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone |
| SMILES | CC1CCN(C(=O)Cc2ccc(Cl)nc2)c2cc(Cl)ccc2S1 |
| InChI | InChI=1S/C17H16Cl2N2OS/c1-11-6-7-21(14-9-13(18)3-4-15(14)23-11)17(22)8-12-2-5-16(19)20-10-12/h2-5,9-11H,6-8H2,1H3 |
| InChIKey | IWZYWYGJQWCGET-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone?
The IUPAC name of 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone (CID 86933717) is 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone.
What is the SMILES notation for 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone?
The canonical SMILES for 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone is CC1CCN(C(=O)Cc2ccc(Cl)nc2)c2cc(Cl)ccc2S1.
What is the InChIKey of 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone?
The InChIKey is IWZYWYGJQWCGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2N2OS/c1-11-6-7-21(14-9-13(18)3-4-15(14)23-11)17(22)8-12-2-5-16(19)20-10-12/h2-5,9-11H,6-8H2,1H3.
What are the key properties of 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone?
1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone has a molecular weight of 367.30 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chloro-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-(6-chloro-3-pyridinyl)ethanone is sourced from PubChem (CID 86933717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).