C24H30N2O2S — CID 86933803
2-methyl-N-[2-methyl-4-(2-methylpiperidine-1-carbonyl)phenyl]-3-phenylsulfanylpropanamide (PubChem CID 86933803) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 2-methyl-N-[2-methyl-4-(2-methylpiperidine-1-carbonyl)phenyl]-3-phenylsulfanylpropanamide.
| Compound Name | 2-methyl-N-[2-methyl-4-(2-methylpiperidine-1-carbonyl)phenyl]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 86933803 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-methyl-N-[2-methyl-4-(2-methylpiperidine-1-carbonyl)phenyl]-3-phenylsulfanylpropanamide |
| SMILES | Cc1cc(C(=O)N2CCCCC2C)ccc1NC(=O)C(C)CSc1ccccc1 |
| InChI | InChI=1S/C24H30N2O2S/c1-17-15-20(24(28)26-14-8-7-9-19(26)3)12-13-22(17)25-23(27)18(2)16-29-21-10-5-4-6-11-21/h4-6,10-13,15,18-19H,7-9,14,16H2,1-3H3,(H,25,27) |
| InChIKey | RVKPMDQKXYRXGN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |