C23H27FN2O4S — CID 86934263
2-(4-fluorophenyl)sulfonyl-N-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)propanamide (PubChem CID 86934263) has the molecular formula C23H27FN2O4S and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-N-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)propanamide.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-N-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 86934263 |
| Molecular Formula | C23H27FN2O4S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-N-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)propanamide |
| SMILES | Cc1ccc(N(CC(=O)N2CCCCC2)C(=O)C(C)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H27FN2O4S/c1-17-6-10-20(11-7-17)26(16-22(27)25-14-4-3-5-15-25)23(28)18(2)31(29,30)21-12-8-19(24)9-13-21/h6-13,18H,3-5,14-16H2,1-2H3 |
| InChIKey | DGJWPEWHJAWFEL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |