About 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide
1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide (PubChem CID 86934774) has the molecular formula C20H25N3O2S
and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide |
| PubChem CID | 86934774 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1S(=O)(=O)N(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H25N3O2S/c1-14-19(15(2)23(21-14)20(3,4)5)26(24,25)22(6)18-12-11-16-9-7-8-10-17(16)13-18/h7-13H,1-6H3 |
| InChIKey | FVSKQOXBJGEBCD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide?
The IUPAC name of 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide (CID 86934774) is 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide.
What is the SMILES notation for 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide?
The canonical SMILES for 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide is Cc1nn(C(C)(C)C)c(C)c1S(=O)(=O)N(C)c1ccc2ccccc2c1.
What is the InChIKey of 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide?
The InChIKey is FVSKQOXBJGEBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O2S/c1-14-19(15(2)23(21-14)20(3,4)5)26(24,25)22(6)18-12-11-16-9-7-8-10-17(16)13-18/h7-13H,1-6H3.
What are the key properties of 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide?
1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide has a molecular weight of 371.51 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-N,3,5-trimethyl-N-naphthalen-2-ylpyrazole-4-sulfonamide is sourced from PubChem (CID 86934774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).