C21H28N6O2S — CID 86934861
1-tert-butyl-3,5-dimethyl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]pyrazole-4-sulfonamide (PubChem CID 86934861) has the molecular formula C21H28N6O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethyl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]pyrazole-4-sulfonamide.
| Compound Name | 1-tert-butyl-3,5-dimethyl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 86934861 |
| Molecular Formula | C21H28N6O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-tert-butyl-3,5-dimethyl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]pyrazole-4-sulfonamide |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1S(=O)(=O)Nc1ccc(-c2nnc3n2CCCC3)cc1 |
| InChI | InChI=1S/C21H28N6O2S/c1-14-19(15(2)27(24-14)21(3,4)5)30(28,29)25-17-11-9-16(10-12-17)20-23-22-18-8-6-7-13-26(18)20/h9-12,25H,6-8,13H2,1-5H3 |
| InChIKey | BAJUSXZVNPIRHS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |