C22H23N5O3S — CID 86936617
N-[4-[3-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidine-1-carbonyl]phenyl]furan-2-carboxamide (PubChem CID 86936617) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is N-[4-[3-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidine-1-carbonyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[3-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidine-1-carbonyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86936617 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[4-[3-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidine-1-carbonyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCC(c3n[nH]c(=S)n3C3CC3)C2)cc1)c1ccco1 |
| InChI | InChI=1S/C22H23N5O3S/c28-20(18-4-2-12-30-18)23-16-7-5-14(6-8-16)21(29)26-11-1-3-15(13-26)19-24-25-22(31)27(19)17-9-10-17/h2,4-8,12,15,17H,1,3,9-11,13H2,(H,23,28)(H,25,31) |
| InChIKey | IBDRIBGMMYJLCO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|