C26H31N3O2 — CID 86936823
2-[benzyl(oxan-4-ylmethyl)amino]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 86936823) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-[benzyl(oxan-4-ylmethyl)amino]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-[benzyl(oxan-4-ylmethyl)amino]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 86936823 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-[benzyl(oxan-4-ylmethyl)amino]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | O=C(CN(Cc1ccccc1)CC1CCOCC1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C26H31N3O2/c30-26(29-13-10-25-23(18-29)22-8-4-5-9-24(22)27-25)19-28(16-20-6-2-1-3-7-20)17-21-11-14-31-15-12-21/h1-9,21,27H,10-19H2 |
| InChIKey | NAHUCHOGSRSUEA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|