C20H29N3O3S — CID 86936902
5-methyl-4-[(4-pentylsulfonylpiperazin-1-yl)methyl]-2-phenyl-1,3-oxazole (PubChem CID 86936902) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 5-methyl-4-[(4-pentylsulfonylpiperazin-1-yl)methyl]-2-phenyl-1,3-oxazole.
| Compound Name | 5-methyl-4-[(4-pentylsulfonylpiperazin-1-yl)methyl]-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 86936902 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 5-methyl-4-[(4-pentylsulfonylpiperazin-1-yl)methyl]-2-phenyl-1,3-oxazole |
| SMILES | CCCCCS(=O)(=O)N1CCN(Cc2nc(-c3ccccc3)oc2C)CC1 |
| InChI | InChI=1S/C20H29N3O3S/c1-3-4-8-15-27(24,25)23-13-11-22(12-14-23)16-19-17(2)26-20(21-19)18-9-6-5-7-10-18/h5-7,9-10H,3-4,8,11-16H2,1-2H3 |
| InChIKey | KLMGFJZHJCXHAG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|