C21H34N4OS+2 — CID 8693764
2-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1,4-diium-1-yl]-N-[(2S)-heptan-2-yl]acetamide (PubChem CID 8693764) has the molecular formula C21H34N4OS+2 and a molecular weight of 390.60 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1,4-diium-1-yl]-N-[(2S)-heptan-2-yl]acetamide.
| Compound Name | 2-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1,4-diium-1-yl]-N-[(2S)-heptan-2-yl]acetamide |
|---|---|
| PubChem CID | 8693764 |
| Molecular Formula | C21H34N4OS+2 |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1,4-diium-1-yl]-N-[(2S)-heptan-2-yl]acetamide |
| SMILES | CCCCC[C@H](C)NC(=O)C[NH+]1CC[NH+](Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H32N4OS/c1-3-4-5-8-17(2)22-20(26)15-24-11-13-25(14-12-24)16-21-23-18-9-6-7-10-19(18)27-21/h6-7,9-10,17H,3-5,8,11-16H2,1-2H3,(H,22,26)/p+2/t17-/m0/s1 |
| InChIKey | MIWIEEDIPIOZSU-KRWDZBQOSA-P |
| XLogP | 0.66 |
| TPSA | 50.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|