C18H18N4O2 — CID 86938939
N'-(5-nitroquinolin-6-yl)-N-phenylpropane-1,3-diamine (PubChem CID 86938939) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is N'-(5-nitroquinolin-6-yl)-N-phenylpropane-1,3-diamine.
| Compound Name | N'-(5-nitroquinolin-6-yl)-N-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 86938939 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N'-(5-nitroquinolin-6-yl)-N-phenylpropane-1,3-diamine |
| SMILES | O=[N+]([O-])c1c(NCCCNc2ccccc2)ccc2ncccc12 |
| InChI | InChI=1S/C18H18N4O2/c23-22(24)18-15-8-4-11-20-16(15)9-10-17(18)21-13-5-12-19-14-6-2-1-3-7-14/h1-4,6-11,19,21H,5,12-13H2 |
| InChIKey | RRXQWCONMNIRRJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|