C21H18ClN3O2 — CID 86939389
1-(2-chlorophenyl)-N,5-dimethyl-N-(4-prop-2-ynoxyphenyl)pyrazole-4-carboxamide (PubChem CID 86939389) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N,5-dimethyl-N-(4-prop-2-ynoxyphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N,5-dimethyl-N-(4-prop-2-ynoxyphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86939389 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-(2-chlorophenyl)-N,5-dimethyl-N-(4-prop-2-ynoxyphenyl)pyrazole-4-carboxamide |
| SMILES | C#CCOc1ccc(N(C)C(=O)c2cnn(-c3ccccc3Cl)c2C)cc1 |
| InChI | InChI=1S/C21H18ClN3O2/c1-4-13-27-17-11-9-16(10-12-17)24(3)21(26)18-14-23-25(15(18)2)20-8-6-5-7-19(20)22/h1,5-12,14H,13H2,2-3H3 |
| InChIKey | FNGORCLAFZSRJY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|