C21H31N5OS — CID 86940052
2-[[cyclopropylmethyl(ethyl)amino]methyl]-4-(2-methoxyphenyl)-5-piperidin-1-yl-1,2,4-triazole-3-thione (PubChem CID 86940052) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 2-[[cyclopropylmethyl(ethyl)amino]methyl]-4-(2-methoxyphenyl)-5-piperidin-1-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclopropylmethyl(ethyl)amino]methyl]-4-(2-methoxyphenyl)-5-piperidin-1-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 86940052 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[[cyclopropylmethyl(ethyl)amino]methyl]-4-(2-methoxyphenyl)-5-piperidin-1-yl-1,2,4-triazole-3-thione |
| SMILES | CCN(CC1CC1)Cn1nc(N2CCCCC2)n(-c2ccccc2OC)c1=S |
| InChI | InChI=1S/C21H31N5OS/c1-3-23(15-17-11-12-17)16-25-21(28)26(18-9-5-6-10-19(18)27-2)20(22-25)24-13-7-4-8-14-24/h5-6,9-10,17H,3-4,7-8,11-16H2,1-2H3 |
| InChIKey | QYYOLLLAWVPGTB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|