C24H31N3O3 — CID 86943270
N-[1-(3-methoxyphenyl)propan-2-yl]-4-[2-(2-methylphenyl)acetyl]piperazine-1-carboxamide (PubChem CID 86943270) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[1-(3-methoxyphenyl)propan-2-yl]-4-[2-(2-methylphenyl)acetyl]piperazine-1-carboxamide.
| Compound Name | N-[1-(3-methoxyphenyl)propan-2-yl]-4-[2-(2-methylphenyl)acetyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86943270 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[1-(3-methoxyphenyl)propan-2-yl]-4-[2-(2-methylphenyl)acetyl]piperazine-1-carboxamide |
| SMILES | COc1cccc(CC(C)NC(=O)N2CCN(C(=O)Cc3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C24H31N3O3/c1-18-7-4-5-9-21(18)17-23(28)26-11-13-27(14-12-26)24(29)25-19(2)15-20-8-6-10-22(16-20)30-3/h4-10,16,19H,11-15,17H2,1-3H3,(H,25,29) |
| InChIKey | ZUKDABMNXXYDPA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |