C21H33N3O2S — CID 86943756
1-[1-(3-methoxyphenyl)propan-2-yl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea (PubChem CID 86943756) has the molecular formula C21H33N3O2S and a molecular weight of 391.58 g/mol. Its IUPAC name is 1-[1-(3-methoxyphenyl)propan-2-yl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea.
| Compound Name | 1-[1-(3-methoxyphenyl)propan-2-yl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 86943756 |
| Molecular Formula | C21H33N3O2S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-[1-(3-methoxyphenyl)propan-2-yl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea |
| SMILES | COc1cccc(CC(C)NC(=O)NCC2(N3CCSCC3)CCCC2)c1 |
| InChI | InChI=1S/C21H33N3O2S/c1-17(14-18-6-5-7-19(15-18)26-2)23-20(25)22-16-21(8-3-4-9-21)24-10-12-27-13-11-24/h5-7,15,17H,3-4,8-14,16H2,1-2H3,(H2,22,23,25) |
| InChIKey | FATACDDGNZSCBB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |