C18H25N3OS2 — CID 8694516
[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 8694516) has the molecular formula C18H25N3OS2 and a molecular weight of 363.55 g/mol. Its IUPAC name is [2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 8694516 |
| Molecular Formula | C18H25N3OS2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | [2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)N[C@@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H25N3OS2/c22-17(14-24-18(23)21-9-4-5-10-21)19-16-8-11-20(13-16)12-15-6-2-1-3-7-15/h1-3,6-7,16H,4-5,8-14H2,(H,19,22)/t16-/m1/s1 |
| InChIKey | JAYZEPNQNMYCBL-MRXNPFEDSA-N |
| XLogP | 2.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|