C15H12F5NO2 — CID 86947132
2,4-bis(difluoromethoxy)-N-[(2-fluorophenyl)methyl]aniline (PubChem CID 86947132) has the molecular formula C15H12F5NO2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 2,4-bis(difluoromethoxy)-N-[(2-fluorophenyl)methyl]aniline.
| Compound Name | 2,4-bis(difluoromethoxy)-N-[(2-fluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 86947132 |
| Molecular Formula | C15H12F5NO2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2,4-bis(difluoromethoxy)-N-[(2-fluorophenyl)methyl]aniline |
| SMILES | Fc1ccccc1CNc1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C15H12F5NO2/c16-11-4-2-1-3-9(11)8-21-12-6-5-10(22-14(17)18)7-13(12)23-15(19)20/h1-7,14-15,21H,8H2 |
| InChIKey | RJNYRGLNPGSZNB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|