C18H13BrF2N4O2 — CID 86947969
N'-(4-bromobenzoyl)-3-(2,4-difluorophenyl)-1-methylpyrazole-4-carbohydrazide (PubChem CID 86947969) has the molecular formula C18H13BrF2N4O2 and a molecular weight of 435.23 g/mol. Its IUPAC name is N'-(4-bromobenzoyl)-3-(2,4-difluorophenyl)-1-methylpyrazole-4-carbohydrazide.
| Compound Name | N'-(4-bromobenzoyl)-3-(2,4-difluorophenyl)-1-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 86947969 |
| Molecular Formula | C18H13BrF2N4O2 |
| Molecular Weight | 435.23 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N'-(4-bromobenzoyl)-3-(2,4-difluorophenyl)-1-methylpyrazole-4-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)c2ccc(Br)cc2)c(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C18H13BrF2N4O2/c1-25-9-14(16(24-25)13-7-6-12(20)8-15(13)21)18(27)23-22-17(26)10-2-4-11(19)5-3-10/h2-9H,1H3,(H,22,26)(H,23,27) |
| InChIKey | XFNRAJRVHOKVQZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|