C19H20F4N2O2 — CID 86949426
2-[4-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-N-(3-phenylpropyl)acetamide (PubChem CID 86949426) has the molecular formula C19H20F4N2O2 and a molecular weight of 384.37 g/mol. Its IUPAC name is 2-[4-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[4-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 86949426 |
| Molecular Formula | C19H20F4N2O2 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[4-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CNc1ccc(F)cc1OCC(F)(F)F)NCCCc1ccccc1 |
| InChI | InChI=1S/C19H20F4N2O2/c20-15-8-9-16(17(11-15)27-13-19(21,22)23)25-12-18(26)24-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,25H,4,7,10,12-13H2,(H,24,26) |
| InChIKey | ZBVVAABTSWANKR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|