C21H26N2O2 — CID 86952245
1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-(4-phenylbutan-2-yl)urea (PubChem CID 86952245) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-(4-phenylbutan-2-yl)urea.
| Compound Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-(4-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 86952245 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-(4-phenylbutan-2-yl)urea |
| SMILES | CC(CCc1ccccc1)NC(=O)NCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C21H26N2O2/c1-16(7-8-17-5-3-2-4-6-17)23-21(24)22-13-11-18-9-10-20-19(15-18)12-14-25-20/h2-6,9-10,15-16H,7-8,11-14H2,1H3,(H2,22,23,24) |
| InChIKey | HYPFKCVOYBQEAG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |