C20H32F4N4O2 — CID 86952573
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carboxamide (PubChem CID 86952573) has the molecular formula C20H32F4N4O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carboxamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86952573 |
| Molecular Formula | C20H32F4N4O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)C2CCCCC2)CC1)N1CCN(CC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C20H32F4N4O2/c21-18(22)20(23,24)14-26-10-12-28(13-11-26)19(30)25-16-6-8-27(9-7-16)17(29)15-4-2-1-3-5-15/h15-16,18H,1-14H2,(H,25,30) |
| InChIKey | OMAOHRZEGNTCSV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|