C18H17FN2O3 — CID 86954695
(7-fluoro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-methyl-5-nitrophenyl)methanone (PubChem CID 86954695) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is (7-fluoro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-methyl-5-nitrophenyl)methanone.
| Compound Name | (7-fluoro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-methyl-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 86954695 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (7-fluoro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-methyl-5-nitrophenyl)methanone |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C(=O)N1CCc2ccc(F)cc2C1C |
| InChI | InChI=1S/C18H17FN2O3/c1-11-3-6-15(21(23)24)10-16(11)18(22)20-8-7-13-4-5-14(19)9-17(13)12(20)2/h3-6,9-10,12H,7-8H2,1-2H3 |
| InChIKey | OAUSVBSTWNRNDJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|