C23H27N3O4 — CID 86954977
(E)-N-[[2-(4-methoxyphenyl)-1-methylpiperidin-3-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 86954977) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (E)-N-[[2-(4-methoxyphenyl)-1-methylpiperidin-3-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-(4-methoxyphenyl)-1-methylpiperidin-3-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 86954977 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (E)-N-[[2-(4-methoxyphenyl)-1-methylpiperidin-3-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(C2C(CNC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)CCCN2C)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-25-15-3-4-19(23(25)18-8-12-21(30-2)13-9-18)16-24-22(27)14-7-17-5-10-20(11-6-17)26(28)29/h5-14,19,23H,3-4,15-16H2,1-2H3,(H,24,27)/b14-7+ |
| InChIKey | JXCYCZSHJZGXQQ-VGOFMYFVSA-N |
| XLogP | 3.82 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|