methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate

C19H19NO3 — CID 86955196

IUPACmethyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate
SMILESCOC(=O)c1ccccc1NC(=O)CC1CCc2ccccc21
InChIInChI=1S/C19H19NO3/c1-23-19(22)16-8-4-5-9-17(16)20-18(21)12-14-11-10-13-6-2-3-7-15(13)14/h2-9,14H,10-12H2,1H3,(H,20,21)
InChIKeyCLCRBABQIRIWHA-UHFFFAOYSA-N
MW309.37 g/mol
LogP3.53
Rot. Bonds4

About methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate

methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate (PubChem CID 86955196) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate.

Molecular Properties

Compound Namemethyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate
PubChem CID86955196
Molecular FormulaC19H19NO3
Molecular Weight309.37 g/mol
Exact Mass309.14
IUPAC Namemethyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate
SMILESCOC(=O)c1ccccc1NC(=O)CC1CCc2ccccc21
InChIInChI=1S/C19H19NO3/c1-23-19(22)16-8-4-5-9-17(16)20-18(21)12-14-11-10-13-6-2-3-7-15(13)14/h2-9,14H,10-12H2,1H3,(H,20,21)
InChIKeyCLCRBABQIRIWHA-UHFFFAOYSA-N
XLogP3.53
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.37
LogP ≤ 53.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate?
The IUPAC name of methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate (CID 86955196) is methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate.
What is the SMILES notation for methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate?
The canonical SMILES for methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate is COC(=O)c1ccccc1NC(=O)CC1CCc2ccccc21.
What is the InChIKey of methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate?
The InChIKey is CLCRBABQIRIWHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3/c1-23-19(22)16-8-4-5-9-17(16)20-18(21)12-14-11-10-13-6-2-3-7-15(13)14/h2-9,14H,10-12H2,1H3,(H,20,21).
What are the key properties of methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate?
methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate has a molecular weight of 309.37 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]benzoate is sourced from PubChem (CID 86955196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).