C24H24N2O2 — CID 8695538
N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide (PubChem CID 8695538) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide.
| Compound Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide |
|---|---|
| PubChem CID | 8695538 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide |
| SMILES | C[C@H](NCC(=O)N[C@H](C)c1cc2ccccc2o1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H24N2O2/c1-16(20-12-7-10-18-8-3-5-11-21(18)20)25-15-24(27)26-17(2)23-14-19-9-4-6-13-22(19)28-23/h3-14,16-17,25H,15H2,1-2H3,(H,26,27)/t16-,17+/m0/s1 |
| InChIKey | OETIKRZODVWAPV-DLBZAZTESA-N |
| XLogP | 5.11 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |