About (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate
(2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate (PubChem CID 86955832) has the molecular formula C20H18O3
and a molecular weight of 306.36 g/mol. Its IUPAC name is (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate.
Molecular Properties
| Compound Name | (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate |
| PubChem CID | 86955832 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate |
| SMILES | C#CCOc1ccccc1OC(=O)CC1CCc2ccccc21 |
| InChI | InChI=1S/C20H18O3/c1-2-13-22-18-9-5-6-10-19(18)23-20(21)14-16-12-11-15-7-3-4-8-17(15)16/h1,3-10,16H,11-14H2 |
| InChIKey | DQFRIWOLBMBBQC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate?
The IUPAC name of (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate (CID 86955832) is (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate.
What is the SMILES notation for (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate?
The canonical SMILES for (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate is C#CCOc1ccccc1OC(=O)CC1CCc2ccccc21.
What is the InChIKey of (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate?
The InChIKey is DQFRIWOLBMBBQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O3/c1-2-13-22-18-9-5-6-10-19(18)23-20(21)14-16-12-11-15-7-3-4-8-17(15)16/h1,3-10,16H,11-14H2.
What are the key properties of (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate?
(2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate has a molecular weight of 306.36 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-prop-2-ynoxyphenyl) 2-(2,3-dihydro-1H-inden-1-yl)acetate is sourced from PubChem (CID 86955832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).