C20H16Cl2N2O4 — CID 86956364
[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]phenyl] 2-(3,4-dichlorophenyl)cyclopropane-1-carboxylate (PubChem CID 86956364) has the molecular formula C20H16Cl2N2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is [4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]phenyl] 2-(3,4-dichlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | [4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]phenyl] 2-(3,4-dichlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 86956364 |
| Molecular Formula | C20H16Cl2N2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]phenyl] 2-(3,4-dichlorophenyl)cyclopropane-1-carboxylate |
| SMILES | Cc1noc(COc2ccc(OC(=O)C3CC3c3ccc(Cl)c(Cl)c3)cc2)n1 |
| InChI | InChI=1S/C20H16Cl2N2O4/c1-11-23-19(28-24-11)10-26-13-3-5-14(6-4-13)27-20(25)16-9-15(16)12-2-7-17(21)18(22)8-12/h2-8,15-16H,9-10H2,1H3 |
| InChIKey | JHNYPLBCUAGVDX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|