About 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one
3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one (PubChem CID 86959123) has the molecular formula C22H27N7O
and a molecular weight of 405.51 g/mol. Its IUPAC name is 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one.
Molecular Properties
| Compound Name | 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one |
| PubChem CID | 86959123 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one |
| SMILES | Cc1nc(N2CCN(C3CCCN(c4ccccc4)C3=O)CC2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C22H27N7O/c1-16-24-20-18(15-23-26(20)2)21(25-16)28-13-11-27(12-14-28)19-9-6-10-29(22(19)30)17-7-4-3-5-8-17/h3-5,7-8,15,19H,6,9-14H2,1-2H3 |
| InChIKey | MJRDIAWFGCEZAO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one?
The IUPAC name of 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one (CID 86959123) is 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one.
What is the SMILES notation for 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one?
The canonical SMILES for 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one is Cc1nc(N2CCN(C3CCCN(c4ccccc4)C3=O)CC2)c2cnn(C)c2n1.
What is the InChIKey of 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one?
The InChIKey is MJRDIAWFGCEZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N7O/c1-16-24-20-18(15-23-26(20)2)21(25-16)28-13-11-27(12-14-28)19-9-6-10-29(22(19)30)17-7-4-3-5-8-17/h3-5,7-8,15,19H,6,9-14H2,1-2H3.
What are the key properties of 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one?
3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one has a molecular weight of 405.51 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-1-phenylpiperidin-2-one is sourced from PubChem (CID 86959123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).