C18H27IN4O — CID 86959463
N-(2-iodophenyl)-2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]acetamide (PubChem CID 86959463) has the molecular formula C18H27IN4O and a molecular weight of 442.35 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-iodophenyl)-2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 86959463 |
| Molecular Formula | C18H27IN4O |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-(2-iodophenyl)-2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]acetamide |
| SMILES | CN1CCCC(N2CCN(CC(=O)Nc3ccccc3I)CC2)C1 |
| InChI | InChI=1S/C18H27IN4O/c1-21-8-4-5-15(13-21)23-11-9-22(10-12-23)14-18(24)20-17-7-3-2-6-16(17)19/h2-3,6-7,15H,4-5,8-14H2,1H3,(H,20,24) |
| InChIKey | VYPXZWXJCVYYFX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|