About cobalt(2+);bis(2-ethylhexanoate)
cobalt(2+);bis(2-ethylhexanoate) (PubChem CID 8696) has the molecular formula C16H30CoO4
and a molecular weight of 345.35 g/mol. Its IUPAC name is cobalt(2+);bis(2-ethylhexanoate).
Molecular Properties
| Compound Name | cobalt(2+);bis(2-ethylhexanoate) |
| PubChem CID | 8696 |
| Molecular Formula | C16H30CoO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | cobalt(2+);bis(2-ethylhexanoate) |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Co+2] |
| InChI | InChI=1S/2C8H16O2.Co/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | QAEKNCDIHIGLFI-UHFFFAOYSA-L |
| XLogP | 1.90 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cobalt(2+);bis(2-ethylhexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(2-ethylhexanoate)?
The IUPAC name of cobalt(2+);bis(2-ethylhexanoate) (CID 8696) is cobalt(2+);bis(2-ethylhexanoate).
What is the SMILES notation for cobalt(2+);bis(2-ethylhexanoate)?
The canonical SMILES for cobalt(2+);bis(2-ethylhexanoate) is CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Co+2].
What is the InChIKey of cobalt(2+);bis(2-ethylhexanoate)?
The InChIKey is QAEKNCDIHIGLFI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H16O2.Co/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2.
What are the key properties of cobalt(2+);bis(2-ethylhexanoate)?
cobalt(2+);bis(2-ethylhexanoate) has a molecular weight of 345.35 g/mol, XLogP of 1.90, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(2-ethylhexanoate) is sourced from PubChem (CID 8696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).