C19H17FO4 — CID 86960299
methyl 3-[[1-(3-fluorophenyl)cyclopropanecarbonyl]oxymethyl]benzoate (PubChem CID 86960299) has the molecular formula C19H17FO4 and a molecular weight of 328.34 g/mol. Its IUPAC name is methyl 3-[[1-(3-fluorophenyl)cyclopropanecarbonyl]oxymethyl]benzoate.
| Compound Name | methyl 3-[[1-(3-fluorophenyl)cyclopropanecarbonyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 86960299 |
| Molecular Formula | C19H17FO4 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 3-[[1-(3-fluorophenyl)cyclopropanecarbonyl]oxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COC(=O)C2(c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C19H17FO4/c1-23-17(21)14-5-2-4-13(10-14)12-24-18(22)19(8-9-19)15-6-3-7-16(20)11-15/h2-7,10-11H,8-9,12H2,1H3 |
| InChIKey | PCTBUQSDDLWANF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |