C26H23N3O3 — CID 86960566
N-[4-(4-cyanophenoxy)phenyl]-N'-[(2-methylcyclopropyl)-phenylmethyl]oxamide (PubChem CID 86960566) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[4-(4-cyanophenoxy)phenyl]-N'-[(2-methylcyclopropyl)-phenylmethyl]oxamide.
| Compound Name | N-[4-(4-cyanophenoxy)phenyl]-N'-[(2-methylcyclopropyl)-phenylmethyl]oxamide |
|---|---|
| PubChem CID | 86960566 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[4-(4-cyanophenoxy)phenyl]-N'-[(2-methylcyclopropyl)-phenylmethyl]oxamide |
| SMILES | CC1CC1C(NC(=O)C(=O)Nc1ccc(Oc2ccc(C#N)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H23N3O3/c1-17-15-23(17)24(19-5-3-2-4-6-19)29-26(31)25(30)28-20-9-13-22(14-10-20)32-21-11-7-18(16-27)8-12-21/h2-14,17,23-24H,15H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | SACBSOYVKZYOSJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|