C24H27N3O2S — CID 86961713
2-(2-cyclopropylbenzimidazol-1-yl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]acetamide (PubChem CID 86961713) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-(2-cyclopropylbenzimidazol-1-yl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]acetamide.
| Compound Name | 2-(2-cyclopropylbenzimidazol-1-yl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86961713 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-(2-cyclopropylbenzimidazol-1-yl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]acetamide |
| SMILES | O=C(Cn1c(C2CC2)nc2ccccc21)Nc1cccc(CSC2CCOCC2)c1 |
| InChI | InChI=1S/C24H27N3O2S/c28-23(15-27-22-7-2-1-6-21(22)26-24(27)18-8-9-18)25-19-5-3-4-17(14-19)16-30-20-10-12-29-13-11-20/h1-7,14,18,20H,8-13,15-16H2,(H,25,28) |
| InChIKey | LZJWEDIRPLCPHP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |