C16H24ClNO4S — CID 86962394
ethyl 4-[[2-(3-chlorophenyl)-2-methylpropyl]sulfamoyl]butanoate (PubChem CID 86962394) has the molecular formula C16H24ClNO4S and a molecular weight of 361.89 g/mol. Its IUPAC name is ethyl 4-[[2-(3-chlorophenyl)-2-methylpropyl]sulfamoyl]butanoate.
| Compound Name | ethyl 4-[[2-(3-chlorophenyl)-2-methylpropyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 86962394 |
| Molecular Formula | C16H24ClNO4S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | ethyl 4-[[2-(3-chlorophenyl)-2-methylpropyl]sulfamoyl]butanoate |
| SMILES | CCOC(=O)CCCS(=O)(=O)NCC(C)(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H24ClNO4S/c1-4-22-15(19)9-6-10-23(20,21)18-12-16(2,3)13-7-5-8-14(17)11-13/h5,7-8,11,18H,4,6,9-10,12H2,1-3H3 |
| InChIKey | SAGLREASDDAXON-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |