C19H26N2O2 — CID 86963264
5-propan-2-yl-N-[3-(4-propan-2-ylphenyl)propyl]-1,3-oxazole-4-carboxamide (PubChem CID 86963264) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 5-propan-2-yl-N-[3-(4-propan-2-ylphenyl)propyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-propan-2-yl-N-[3-(4-propan-2-ylphenyl)propyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 86963264 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 5-propan-2-yl-N-[3-(4-propan-2-ylphenyl)propyl]-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)c1ccc(CCCNC(=O)c2ncoc2C(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O2/c1-13(2)16-9-7-15(8-10-16)6-5-11-20-19(22)17-18(14(3)4)23-12-21-17/h7-10,12-14H,5-6,11H2,1-4H3,(H,20,22) |
| InChIKey | MQJCEOQSSBPGRH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|