C14H16N8O2 — CID 86964265
methyl 2-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]acetate (PubChem CID 86964265) has the molecular formula C14H16N8O2 and a molecular weight of 328.34 g/mol. Its IUPAC name is methyl 2-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]acetate.
| Compound Name | methyl 2-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 86964265 |
| Molecular Formula | C14H16N8O2 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 2-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc2c(NC3CCc4ncnn4C3)ncnc21 |
| InChI | InChI=1S/C14H16N8O2/c1-24-12(23)6-22-14-10(4-18-22)13(16-7-17-14)20-9-2-3-11-15-8-19-21(11)5-9/h4,7-9H,2-3,5-6H2,1H3,(H,16,17,20) |
| InChIKey | IIZJEHXPYQQRDU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |